C22H27ClFNO3S — CID 89402846
N-[4-(2-adamantyl)-2-methyl-3-oxopent-4-en-2-yl]-2-chloro-4-fluorobenzenesulfonamide (PubChem CID 89402846) has the molecular formula C22H27ClFNO3S and a molecular weight of 439.98 g/mol. Its IUPAC name is N-[4-(2-adamantyl)-2-methyl-3-oxopent-4-en-2-yl]-2-chloro-4-fluorobenzenesulfonamide.
| Compound Name | N-[4-(2-adamantyl)-2-methyl-3-oxopent-4-en-2-yl]-2-chloro-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 89402846 |
| Molecular Formula | C22H27ClFNO3S |
| Molecular Weight | 439.98 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-[4-(2-adamantyl)-2-methyl-3-oxopent-4-en-2-yl]-2-chloro-4-fluorobenzenesulfonamide |
| SMILES | C=C(C(=O)C(C)(C)NS(=O)(=O)c1ccc(F)cc1Cl)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H27ClFNO3S/c1-12(20-15-7-13-6-14(9-15)10-16(20)8-13)21(26)22(2,3)25-29(27,28)19-5-4-17(24)11-18(19)23/h4-5,11,13-16,20,25H,1,6-10H2,2-3H3 |
| InChIKey | YRNHGEFMWKHGGO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.98 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|