C21H25BN2O5S — CID 89402857
CID 89402857 (PubChem CID 89402857) has the molecular formula C21H25BN2O5S and a molecular weight of 428.32 g/mol.
| Compound Name | CID 89402857 |
|---|---|
| PubChem CID | 89402857 |
| Molecular Formula | C21H25BN2O5S |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | — |
| SMILES | [B]c1ccccc1S(=O)(=O)NC1(C(=O)NC2C3CC4CC2CC(C(=O)O)(C4)C3)CC1 |
| InChI | InChI=1S/C21H25BN2O5S/c22-15-3-1-2-4-16(15)30(28,29)24-21(5-6-21)18(25)23-17-13-7-12-8-14(17)11-20(9-12,10-13)19(26)27/h1-4,12-14,17,24H,5-11H2,(H,23,25)(H,26,27) |
| InChIKey | XCFZGKRKOKBBOK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|