About CID 89402857
CID 89402857 (PubChem CID 89402857) has the molecular formula C21H25BN2O5S
and a molecular weight of 428.32 g/mol.
Molecular Properties
| Compound Name | CID 89402857 |
| PubChem CID | 89402857 |
| Molecular Formula | C21H25BN2O5S |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | — |
| SMILES | [B]c1ccccc1S(=O)(=O)NC1(C(=O)NC2C3CC4CC2CC(C(=O)O)(C4)C3)CC1 |
| InChI | InChI=1S/C21H25BN2O5S/c22-15-3-1-2-4-16(15)30(28,29)24-21(5-6-21)18(25)23-17-13-7-12-8-14(17)11-20(9-12,10-13)19(26)27/h1-4,12-14,17,24H,5-11H2,(H,23,25)(H,26,27) |
| InChIKey | XCFZGKRKOKBBOK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89402857 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89402857?
The IUPAC name of CID 89402857 (CID 89402857) is not available.
What is the SMILES notation for CID 89402857?
The canonical SMILES for CID 89402857 is [B]c1ccccc1S(=O)(=O)NC1(C(=O)NC2C3CC4CC2CC(C(=O)O)(C4)C3)CC1.
What is the InChIKey of CID 89402857?
The InChIKey is XCFZGKRKOKBBOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25BN2O5S/c22-15-3-1-2-4-16(15)30(28,29)24-21(5-6-21)18(25)23-17-13-7-12-8-14(17)11-20(9-12,10-13)19(26)27/h1-4,12-14,17,24H,5-11H2,(H,23,25)(H,26,27).
What are the key properties of CID 89402857?
CID 89402857 has a molecular weight of 428.32 g/mol, XLogP of 0.69, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89402857 is sourced from PubChem (CID 89402857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).