C25H26N4O2S — CID 89406185
4-N-[2-(1,1-dihydroxy-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]benzene-1,4-diamine (PubChem CID 89406185) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is 4-N-[2-(1,1-dihydroxy-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[2-(1,1-dihydroxy-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 89406185 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 4-N-[2-(1,1-dihydroxy-3,5-dihydro-2H-1λ4,4-benzothiazepin-4-yl)-6-methylquinolin-4-yl]benzene-1,4-diamine |
| SMILES | Cc1ccc2nc(N3CCS(O)(O)c4ccccc4C3)cc(Nc3ccc(N)cc3)c2c1 |
| InChI | InChI=1S/C25H26N4O2S/c1-17-6-11-22-21(14-17)23(27-20-9-7-19(26)8-10-20)15-25(28-22)29-12-13-32(30,31)24-5-3-2-4-18(24)16-29/h2-11,14-15,30-31H,12-13,16,26H2,1H3,(H,27,28) |
| InChIKey | GVJGFYMGKIQNQO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|