C38H29N5O2 — CID 89407723
N-[1-[(4-formylphenyl)methyl]pyrazol-4-yl]-1-tritylindazole-3-carboxamide (PubChem CID 89407723) has the molecular formula C38H29N5O2 and a molecular weight of 587.68 g/mol. Its IUPAC name is N-[1-[(4-formylphenyl)methyl]pyrazol-4-yl]-1-tritylindazole-3-carboxamide.
| Compound Name | N-[1-[(4-formylphenyl)methyl]pyrazol-4-yl]-1-tritylindazole-3-carboxamide |
|---|---|
| PubChem CID | 89407723 |
| Molecular Formula | C38H29N5O2 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | N-[1-[(4-formylphenyl)methyl]pyrazol-4-yl]-1-tritylindazole-3-carboxamide |
| SMILES | O=Cc1ccc(Cn2cc(NC(=O)c3nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c4ccccc34)cn2)cc1 |
| InChI | InChI=1S/C38H29N5O2/c44-27-29-22-20-28(21-23-29)25-42-26-33(24-39-42)40-37(45)36-34-18-10-11-19-35(34)43(41-36)38(30-12-4-1-5-13-30,31-14-6-2-7-15-31)32-16-8-3-9-17-32/h1-24,26-27H,25H2,(H,40,45) |
| InChIKey | VNHHAKBSSYVJTD-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|