C33H53NO3 — CID 89409878
[(3aS,5aS,5bR,9S,11aR,11bR,13aR)-13a-amino-5a,5b,8,8,11a-pentamethyl-3a-(oxiran-2-yl)-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-2H-cyclopenta[a]chrysen-9-yl] acetate (PubChem CID 89409878) has the molecular formula C33H53NO3 and a molecular weight of 511.79 g/mol. Its IUPAC name is [(3aS,5aS,5bR,9S,11aR,11bR,13aR)-13a-amino-5a,5b,8,8,11a-pentamethyl-3a-(oxiran-2-yl)-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-2H-cyclopenta[a]chrysen-9-yl] acetate.
| Compound Name | [(3aS,5aS,5bR,9S,11aR,11bR,13aR)-13a-amino-5a,5b,8,8,11a-pentamethyl-3a-(oxiran-2-yl)-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-2H-cyclopenta[a]chrysen-9-yl] acetate |
|---|---|
| PubChem CID | 89409878 |
| Molecular Formula | C33H53NO3 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 511.40 |
| IUPAC Name | [(3aS,5aS,5bR,9S,11aR,11bR,13aR)-13a-amino-5a,5b,8,8,11a-pentamethyl-3a-(oxiran-2-yl)-1-propan-2-yl-3,4,5,6,7,7a,9,10,11,11b,12,13-dodecahydro-2H-cyclopenta[a]chrysen-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@]3(C)[C@@H]2CC[C@]2(N)C4=C(C(C)C)CC[C@]4(C4CO4)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C33H53NO3/c1-20(2)22-9-15-32(26-19-36-26)18-17-31(8)30(7)14-10-23-28(4,5)25(37-21(3)35)12-13-29(23,6)24(30)11-16-33(31,34)27(22)32/h20,23-26H,9-19,34H2,1-8H3/t23?,24-,25+,26?,29+,30-,31+,32-,33+/m1/s1 |
| InChIKey | BUFFYUKHOIJXRC-JQUMXLBWSA-N |
| XLogP | 7.20 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|