C7H10N4O2S2 — CID 89413158
carbamothioic S-acid;pyrimidin-5-ylmethylcarbamothioic S-acid (PubChem CID 89413158) has the molecular formula C7H10N4O2S2 and a molecular weight of 246.32 g/mol. Its IUPAC name is carbamothioic S-acid;pyrimidin-5-ylmethylcarbamothioic S-acid.
| Compound Name | carbamothioic S-acid;pyrimidin-5-ylmethylcarbamothioic S-acid |
|---|---|
| PubChem CID | 89413158 |
| Molecular Formula | C7H10N4O2S2 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | carbamothioic S-acid;pyrimidin-5-ylmethylcarbamothioic S-acid |
| SMILES | NC(=O)S.O=C(S)NCc1cncnc1 |
| InChI | InChI=1S/C6H7N3OS.CH3NOS/c10-6(11)9-3-5-1-7-4-8-2-5;2-1(3)4/h1-2,4H,3H2,(H2,9,10,11);(H3,2,3,4) |
| InChIKey | AUTGHKCPSFWYHF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|