About pyrimidine-5-carboxamide;tetrahydrochloride
pyrimidine-5-carboxamide;tetrahydrochloride (PubChem CID 141352589) has the molecular formula C5H9Cl4N3O
and a molecular weight of 268.96 g/mol. Its IUPAC name is pyrimidine-5-carboxamide;tetrahydrochloride.
Molecular Properties
| Compound Name | pyrimidine-5-carboxamide;tetrahydrochloride |
| PubChem CID | 141352589 |
| Molecular Formula | C5H9Cl4N3O |
| Molecular Weight | 268.96 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | pyrimidine-5-carboxamide;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.NC(=O)c1cncnc1 |
| InChI | InChI=1S/C5H5N3O.4ClH/c6-5(9)4-1-7-3-8-2-4;;;;/h1-3H,(H2,6,9);4*1H |
| InChIKey | FUDLZDNYQVCOGM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.96 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrimidine-5-carboxamide;tetrahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidine-5-carboxamide;tetrahydrochloride?
The IUPAC name of pyrimidine-5-carboxamide;tetrahydrochloride (CID 141352589) is pyrimidine-5-carboxamide;tetrahydrochloride.
What is the SMILES notation for pyrimidine-5-carboxamide;tetrahydrochloride?
The canonical SMILES for pyrimidine-5-carboxamide;tetrahydrochloride is Cl.Cl.Cl.Cl.NC(=O)c1cncnc1.
What is the InChIKey of pyrimidine-5-carboxamide;tetrahydrochloride?
The InChIKey is FUDLZDNYQVCOGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O.4ClH/c6-5(9)4-1-7-3-8-2-4;;;;/h1-3H,(H2,6,9);4*1H.
What are the key properties of pyrimidine-5-carboxamide;tetrahydrochloride?
pyrimidine-5-carboxamide;tetrahydrochloride has a molecular weight of 268.96 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidine-5-carboxamide;tetrahydrochloride is sourced from PubChem (CID 141352589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).