About (carbamoylamino) pyrimidine-5-carboxylate
(carbamoylamino) pyrimidine-5-carboxylate (PubChem CID 174908847) has the molecular formula C6H6N4O3
and a molecular weight of 182.14 g/mol. Its IUPAC name is (carbamoylamino) pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | (carbamoylamino) pyrimidine-5-carboxylate |
| PubChem CID | 174908847 |
| Molecular Formula | C6H6N4O3 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | (carbamoylamino) pyrimidine-5-carboxylate |
| SMILES | NC(=O)NOC(=O)c1cncnc1 |
| InChI | InChI=1S/C6H6N4O3/c7-6(12)10-13-5(11)4-1-8-3-9-2-4/h1-3H,(H3,7,10,12) |
| InChIKey | NFGCUDXRFGHSJO-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (carbamoylamino) pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (carbamoylamino) pyrimidine-5-carboxylate?
The IUPAC name of (carbamoylamino) pyrimidine-5-carboxylate (CID 174908847) is (carbamoylamino) pyrimidine-5-carboxylate.
What is the SMILES notation for (carbamoylamino) pyrimidine-5-carboxylate?
The canonical SMILES for (carbamoylamino) pyrimidine-5-carboxylate is NC(=O)NOC(=O)c1cncnc1.
What is the InChIKey of (carbamoylamino) pyrimidine-5-carboxylate?
The InChIKey is NFGCUDXRFGHSJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O3/c7-6(12)10-13-5(11)4-1-8-3-9-2-4/h1-3H,(H3,7,10,12).
What are the key properties of (carbamoylamino) pyrimidine-5-carboxylate?
(carbamoylamino) pyrimidine-5-carboxylate has a molecular weight of 182.14 g/mol, XLogP of -0.78, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (carbamoylamino) pyrimidine-5-carboxylate is sourced from PubChem (CID 174908847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).