About methylsulfanylmethyl pyrimidine-5-carboxylate
methylsulfanylmethyl pyrimidine-5-carboxylate (PubChem CID 141203447) has the molecular formula C7H8N2O2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is methylsulfanylmethyl pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | methylsulfanylmethyl pyrimidine-5-carboxylate |
| PubChem CID | 141203447 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | methylsulfanylmethyl pyrimidine-5-carboxylate |
| SMILES | CSCOC(=O)c1cncnc1 |
| InChI | InChI=1S/C7H8N2O2S/c1-12-5-11-7(10)6-2-8-4-9-3-6/h2-4H,5H2,1H3 |
| InChIKey | FKWBYLRMMJTYJG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanylmethyl pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanylmethyl pyrimidine-5-carboxylate?
The IUPAC name of methylsulfanylmethyl pyrimidine-5-carboxylate (CID 141203447) is methylsulfanylmethyl pyrimidine-5-carboxylate.
What is the SMILES notation for methylsulfanylmethyl pyrimidine-5-carboxylate?
The canonical SMILES for methylsulfanylmethyl pyrimidine-5-carboxylate is CSCOC(=O)c1cncnc1.
What is the InChIKey of methylsulfanylmethyl pyrimidine-5-carboxylate?
The InChIKey is FKWBYLRMMJTYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2S/c1-12-5-11-7(10)6-2-8-4-9-3-6/h2-4H,5H2,1H3.
What are the key properties of methylsulfanylmethyl pyrimidine-5-carboxylate?
methylsulfanylmethyl pyrimidine-5-carboxylate has a molecular weight of 184.22 g/mol, XLogP of 0.95, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanylmethyl pyrimidine-5-carboxylate is sourced from PubChem (CID 141203447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).