About [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate
[4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate (PubChem CID 135308129) has the molecular formula C15H16N2O2
and a molecular weight of 256.31 g/mol. Its IUPAC name is [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate |
| PubChem CID | 135308129 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate |
| SMILES | CC(C)Cc1ccc(OC(=O)c2cncnc2)cc1 |
| InChI | InChI=1S/C15H16N2O2/c1-11(2)7-12-3-5-14(6-4-12)19-15(18)13-8-16-10-17-9-13/h3-6,8-11H,7H2,1-2H3 |
| InChIKey | KZNQFYVWEHFNGW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate?
The IUPAC name of [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate (CID 135308129) is [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate.
What is the SMILES notation for [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate?
The canonical SMILES for [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate is CC(C)Cc1ccc(OC(=O)c2cncnc2)cc1.
What is the InChIKey of [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate?
The InChIKey is KZNQFYVWEHFNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2/c1-11(2)7-12-3-5-14(6-4-12)19-15(18)13-8-16-10-17-9-13/h3-6,8-11H,7H2,1-2H3.
What are the key properties of [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate?
[4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate has a molecular weight of 256.31 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methylpropyl)phenyl] pyrimidine-5-carboxylate is sourced from PubChem (CID 135308129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).