C27H37N5O5 — CID 89413303
N-hydroxy-N'-methyl-2-[methyl-[4-[4-(5-morpholin-4-ylpentylamino)phenyl]benzoyl]amino]propanediamide (PubChem CID 89413303) has the molecular formula C27H37N5O5 and a molecular weight of 511.62 g/mol. Its IUPAC name is N-hydroxy-N'-methyl-2-[methyl-[4-[4-(5-morpholin-4-ylpentylamino)phenyl]benzoyl]amino]propanediamide.
| Compound Name | N-hydroxy-N'-methyl-2-[methyl-[4-[4-(5-morpholin-4-ylpentylamino)phenyl]benzoyl]amino]propanediamide |
|---|---|
| PubChem CID | 89413303 |
| Molecular Formula | C27H37N5O5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | N-hydroxy-N'-methyl-2-[methyl-[4-[4-(5-morpholin-4-ylpentylamino)phenyl]benzoyl]amino]propanediamide |
| SMILES | CNC(=O)C(C(=O)NO)N(C)C(=O)c1ccc(-c2ccc(NCCCCCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C27H37N5O5/c1-28-25(33)24(26(34)30-36)31(2)27(35)22-8-6-20(7-9-22)21-10-12-23(13-11-21)29-14-4-3-5-15-32-16-18-37-19-17-32/h6-13,24,29,36H,3-5,14-19H2,1-2H3,(H,28,33)(H,30,34) |
| InChIKey | AHGBPPGABCCFEY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|