C27H34N4O6 — CID 89413350
N-hydroxy-N'-methyl-2-[methyl-[4-[4-[[1-(morpholin-4-ylmethyl)cyclopropyl]methoxy]phenyl]benzoyl]amino]propanediamide (PubChem CID 89413350) has the molecular formula C27H34N4O6 and a molecular weight of 510.59 g/mol. Its IUPAC name is N-hydroxy-N'-methyl-2-[methyl-[4-[4-[[1-(morpholin-4-ylmethyl)cyclopropyl]methoxy]phenyl]benzoyl]amino]propanediamide.
| Compound Name | N-hydroxy-N'-methyl-2-[methyl-[4-[4-[[1-(morpholin-4-ylmethyl)cyclopropyl]methoxy]phenyl]benzoyl]amino]propanediamide |
|---|---|
| PubChem CID | 89413350 |
| Molecular Formula | C27H34N4O6 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | N-hydroxy-N'-methyl-2-[methyl-[4-[4-[[1-(morpholin-4-ylmethyl)cyclopropyl]methoxy]phenyl]benzoyl]amino]propanediamide |
| SMILES | CNC(=O)C(C(=O)NO)N(C)C(=O)c1ccc(-c2ccc(OCC3(CN4CCOCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H34N4O6/c1-28-24(32)23(25(33)29-35)30(2)26(34)21-5-3-19(4-6-21)20-7-9-22(10-8-20)37-18-27(11-12-27)17-31-13-15-36-16-14-31/h3-10,23,35H,11-18H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | NHQQPPUUSBKESN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|