C25H32N4O6 — CID 71598730
(2S)-N-hydroxy-N',2-dimethyl-2-[methyl-[4-[4-(2-morpholin-4-ylethoxy)phenyl]benzoyl]amino]propanediamide (PubChem CID 71598730) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is (2S)-N-hydroxy-N',2-dimethyl-2-[methyl-[4-[4-(2-morpholin-4-ylethoxy)phenyl]benzoyl]amino]propanediamide.
| Compound Name | (2S)-N-hydroxy-N',2-dimethyl-2-[methyl-[4-[4-(2-morpholin-4-ylethoxy)phenyl]benzoyl]amino]propanediamide |
|---|---|
| PubChem CID | 71598730 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (2S)-N-hydroxy-N',2-dimethyl-2-[methyl-[4-[4-(2-morpholin-4-ylethoxy)phenyl]benzoyl]amino]propanediamide |
| SMILES | CNC(=O)[C@@](C)(C(=O)NO)N(C)C(=O)c1ccc(-c2ccc(OCCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C25H32N4O6/c1-25(23(31)26-2,24(32)27-33)28(3)22(30)20-6-4-18(5-7-20)19-8-10-21(11-9-19)35-17-14-29-12-15-34-16-13-29/h4-11,33H,12-17H2,1-3H3,(H,26,31)(H,27,32)/t25-/m0/s1 |
| InChIKey | LQAWACHJLNKKMG-VWLOTQADSA-N |
| XLogP | 1.15 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|