C25H28N2O3 — CID 172655306
N,N-dimethyl-4-[3-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide (PubChem CID 172655306) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide.
| Compound Name | N,N-dimethyl-4-[3-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 172655306 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N,N-dimethyl-4-[3-(2-morpholin-4-ylethoxy)naphthalen-1-yl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2cc(OCCN3CCOCC3)cc3ccccc23)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-26(2)25(28)20-9-7-19(8-10-20)24-18-22(17-21-5-3-4-6-23(21)24)30-16-13-27-11-14-29-15-12-27/h3-10,17-18H,11-16H2,1-2H3 |
| InChIKey | VRMHENCMVYENQG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |