C19H17FN2O2S2 — CID 8941359
(E)-3-(3-fluoro-4-methoxyphenyl)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]prop-2-enamide (PubChem CID 8941359) has the molecular formula C19H17FN2O2S2 and a molecular weight of 388.49 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-methoxyphenyl)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 8941359 |
| Molecular Formula | C19H17FN2O2S2 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCc2ccc(-c3csc(C)n3)s2)cc1F |
| InChI | InChI=1S/C19H17FN2O2S2/c1-12-22-16(11-25-12)18-7-5-14(26-18)10-21-19(23)8-4-13-3-6-17(24-2)15(20)9-13/h3-9,11H,10H2,1-2H3,(H,21,23)/b8-4+ |
| InChIKey | NWZAOFNSVHZOFC-XBXARRHUSA-N |
| XLogP | 4.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|