C22H22F2N6O2 — CID 89414408
2-fluoro-7-(4-fluorophenyl)-8-[2-(3-hydroxypropyl)-1,2,4-triazol-3-yl]-2,3,11-triazatricyclo[7.4.1.05,14]tetradeca-1(13),5(14),9-trien-12-one (PubChem CID 89414408) has the molecular formula C22H22F2N6O2 and a molecular weight of 440.45 g/mol. Its IUPAC name is 2-fluoro-7-(4-fluorophenyl)-8-[2-(3-hydroxypropyl)-1,2,4-triazol-3-yl]-2,3,11-triazatricyclo[7.4.1.05,14]tetradeca-1(13),5(14),9-trien-12-one.
| Compound Name | 2-fluoro-7-(4-fluorophenyl)-8-[2-(3-hydroxypropyl)-1,2,4-triazol-3-yl]-2,3,11-triazatricyclo[7.4.1.05,14]tetradeca-1(13),5(14),9-trien-12-one |
|---|---|
| PubChem CID | 89414408 |
| Molecular Formula | C22H22F2N6O2 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-fluoro-7-(4-fluorophenyl)-8-[2-(3-hydroxypropyl)-1,2,4-triazol-3-yl]-2,3,11-triazatricyclo[7.4.1.05,14]tetradeca-1(13),5(14),9-trien-12-one |
| SMILES | O=C1C=C2C3=C(CNN2F)CC(c2ccc(F)cc2)C(c2ncnn2CCCO)C3=CN1 |
| InChI | InChI=1S/C22H22F2N6O2/c23-15-4-2-13(3-5-15)16-8-14-10-27-30(24)18-9-19(32)25-11-17(20(14)18)21(16)22-26-12-28-29(22)6-1-7-31/h2-5,9,11-12,16,21,27,31H,1,6-8,10H2,(H,25,32) |
| InChIKey | KIYJPCLXEQBMFI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|