C25H27FN8O — CID 136511255
12-[4-(azetidin-1-ylmethyl)phenyl]-7-fluoro-13-(2-propyl-1,2,4-triazol-3-yl)-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one (PubChem CID 136511255) has the molecular formula C25H27FN8O and a molecular weight of 474.54 g/mol. Its IUPAC name is 12-[4-(azetidin-1-ylmethyl)phenyl]-7-fluoro-13-(2-propyl-1,2,4-triazol-3-yl)-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one.
| Compound Name | 12-[4-(azetidin-1-ylmethyl)phenyl]-7-fluoro-13-(2-propyl-1,2,4-triazol-3-yl)-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 136511255 |
| Molecular Formula | C25H27FN8O |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 12-[4-(azetidin-1-ylmethyl)phenyl]-7-fluoro-13-(2-propyl-1,2,4-triazol-3-yl)-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one |
| SMILES | CCCn1ncnc1C1c2n[nH]c(=O)c3cc(F)cc(c23)NNC1c1ccc(CN2CCC2)cc1 |
| InChI | InChI=1S/C25H27FN8O/c1-2-8-34-24(27-14-28-34)21-22(16-6-4-15(5-7-16)13-33-9-3-10-33)30-29-19-12-17(26)11-18-20(19)23(21)31-32-25(18)35/h4-7,11-12,14,21-22,29-30H,2-3,8-10,13H2,1H3,(H,32,35) |
| InChIKey | MMMFONSBWRQVIV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |