C24H25FN8O — CID 136511289
12-[4-(azetidin-1-ylmethyl)phenyl]-13-(2-ethyl-1,2,4-triazol-3-yl)-7-fluoro-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one (PubChem CID 136511289) has the molecular formula C24H25FN8O and a molecular weight of 460.52 g/mol. Its IUPAC name is 12-[4-(azetidin-1-ylmethyl)phenyl]-13-(2-ethyl-1,2,4-triazol-3-yl)-7-fluoro-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one.
| Compound Name | 12-[4-(azetidin-1-ylmethyl)phenyl]-13-(2-ethyl-1,2,4-triazol-3-yl)-7-fluoro-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 136511289 |
| Molecular Formula | C24H25FN8O |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 12-[4-(azetidin-1-ylmethyl)phenyl]-13-(2-ethyl-1,2,4-triazol-3-yl)-7-fluoro-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one |
| SMILES | CCn1ncnc1C1c2n[nH]c(=O)c3cc(F)cc(c23)NNC1c1ccc(CN2CCC2)cc1 |
| InChI | InChI=1S/C24H25FN8O/c1-2-33-23(26-13-27-33)20-21(15-6-4-14(5-7-15)12-32-8-3-9-32)29-28-18-11-16(25)10-17-19(18)22(20)30-31-24(17)34/h4-7,10-11,13,20-21,28-29H,2-3,8-9,12H2,1H3,(H,31,34) |
| InChIKey | OCXPHPNQGDUUGV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |