C26H27FN6O — CID 157407508
12-[4-(azetidin-1-ylmethyl)phenyl]-13-(2-ethyl-1,2,4-triazol-3-yl)-7-fluoro-2,11-diazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14)-tetraen-4-one (PubChem CID 157407508) has the molecular formula C26H27FN6O and a molecular weight of 458.54 g/mol. Its IUPAC name is 12-[4-(azetidin-1-ylmethyl)phenyl]-13-(2-ethyl-1,2,4-triazol-3-yl)-7-fluoro-2,11-diazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14)-tetraen-4-one.
| Compound Name | 12-[4-(azetidin-1-ylmethyl)phenyl]-13-(2-ethyl-1,2,4-triazol-3-yl)-7-fluoro-2,11-diazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14)-tetraen-4-one |
|---|---|
| PubChem CID | 157407508 |
| Molecular Formula | C26H27FN6O |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 12-[4-(azetidin-1-ylmethyl)phenyl]-13-(2-ethyl-1,2,4-triazol-3-yl)-7-fluoro-2,11-diazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14)-tetraen-4-one |
| SMILES | CCn1ncnc1C1C2=NCC(=O)c3cc(F)cc(c32)CNC1c1ccc(CN2CCC2)cc1 |
| InChI | InChI=1S/C26H27FN6O/c1-2-33-26(30-15-31-33)23-24(17-6-4-16(5-7-17)14-32-8-3-9-32)28-12-18-10-19(27)11-20-21(34)13-29-25(23)22(18)20/h4-7,10-11,15,23-24,28H,2-3,8-9,12-14H2,1H3 |
| InChIKey | BNWXPPMADTYZGW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |