C17H26N2O7 — CID 89415235
methyl (4S)-5-[[(2S)-1-methoxy-1-oxopent-4-yn-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 89415235) has the molecular formula C17H26N2O7 and a molecular weight of 370.40 g/mol. Its IUPAC name is methyl (4S)-5-[[(2S)-1-methoxy-1-oxopent-4-yn-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | methyl (4S)-5-[[(2S)-1-methoxy-1-oxopent-4-yn-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 89415235 |
| Molecular Formula | C17H26N2O7 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | methyl (4S)-5-[[(2S)-1-methoxy-1-oxopent-4-yn-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | C#CC[C@H](NC(=O)[C@H](CCC(=O)OC)NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C17H26N2O7/c1-7-8-12(15(22)25-6)18-14(21)11(9-10-13(20)24-5)19-16(23)26-17(2,3)4/h1,11-12H,8-10H2,2-6H3,(H,18,21)(H,19,23)/t11-,12-/m0/s1 |
| InChIKey | JJMHNFWINZXTRT-RYUDHWBXSA-N |
| XLogP | 0.51 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|