C21H20N4O — CID 89415255
(E)-N-methoxy-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-6H-quinazolin-5-imine (PubChem CID 89415255) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is (E)-N-methoxy-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-6H-quinazolin-5-imine.
| Compound Name | (E)-N-methoxy-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-6H-quinazolin-5-imine |
|---|---|
| PubChem CID | 89415255 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (E)-N-methoxy-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-6H-quinazolin-5-imine |
| SMILES | CO/N=C1\CCCc2nc(-c3cccc(C)n3)nc(-c3ccccc3)c21 |
| InChI | InChI=1S/C21H20N4O/c1-14-8-6-13-18(22-14)21-23-16-11-7-12-17(25-26-2)19(16)20(24-21)15-9-4-3-5-10-15/h3-6,8-10,13H,7,11-12H2,1-2H3/b25-17+ |
| InChIKey | KULYBSRQRRRURH-KOEQRZSOSA-N |
| XLogP | 4.20 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|