C36H26FN9O5S2 — CID 89419122
1-[1,2-bis(1,3-benzodioxol-5-yl)-1-[5-(6-methoxy-3-pyridinyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]ethyl]-1-[5-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]hydrazine (PubChem CID 89419122) has the molecular formula C36H26FN9O5S2 and a molecular weight of 747.79 g/mol. Its IUPAC name is 1-[1,2-bis(1,3-benzodioxol-5-yl)-1-[5-(6-methoxy-3-pyridinyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]ethyl]-1-[5-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]hydrazine.
| Compound Name | 1-[1,2-bis(1,3-benzodioxol-5-yl)-1-[5-(6-methoxy-3-pyridinyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]ethyl]-1-[5-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 89419122 |
| Molecular Formula | C36H26FN9O5S2 |
| Molecular Weight | 747.79 g/mol |
| Exact Mass | 747.15 |
| IUPAC Name | 1-[1,2-bis(1,3-benzodioxol-5-yl)-1-[5-(6-methoxy-3-pyridinyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]ethyl]-1-[5-(3-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazol-2-yl]hydrazine |
| SMILES | COc1ccc(-c2cnc3sc(C(Cc4ccc5c(c4)OCO5)(c4ccc5c(c4)OCO5)N(N)c4nn5c(-c6cccc(F)c6)cnc5s4)nn23)cn1 |
| InChI | InChI=1S/C36H26FN9O5S2/c1-47-31-10-6-22(15-39-31)26-17-40-33-44(26)42-32(52-33)36(23-7-9-28-30(13-23)51-19-49-28,14-20-5-8-27-29(11-20)50-18-48-27)46(38)35-43-45-25(16-41-34(45)53-35)21-3-2-4-24(37)12-21/h2-13,15-17H,14,18-19,38H2,1H3 |
| InChIKey | NRPIRZFBQASERL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 148.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.79 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|