C11H10NO4S- — CID 89421725
methyl 3-(3-oxido-2-oxo-1,3-benzothiazol-6-yl)propanoate (PubChem CID 89421725) has the molecular formula C11H10NO4S- and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 3-(3-oxido-2-oxo-1,3-benzothiazol-6-yl)propanoate.
| Compound Name | methyl 3-(3-oxido-2-oxo-1,3-benzothiazol-6-yl)propanoate |
|---|---|
| PubChem CID | 89421725 |
| Molecular Formula | C11H10NO4S- |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | methyl 3-(3-oxido-2-oxo-1,3-benzothiazol-6-yl)propanoate |
| SMILES | COC(=O)CCc1ccc2c(c1)sc(=O)n2[O-] |
| InChI | InChI=1S/C11H10NO4S/c1-16-10(13)5-3-7-2-4-8-9(6-7)17-11(14)12(8)15/h2,4,6H,3,5H2,1H3/q-1 |
| InChIKey | WOHOMMJULNMYCS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 71.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|