C26H20ClIN6O2 — CID 89422697
3-[2-[(2-chloro-5-iodopyrimidin-4-yl)amino]ethyl]-8-(2-methoxypyrimidin-5-yl)-2-phenylisoquinolin-1-one (PubChem CID 89422697) has the molecular formula C26H20ClIN6O2 and a molecular weight of 610.84 g/mol. Its IUPAC name is 3-[2-[(2-chloro-5-iodopyrimidin-4-yl)amino]ethyl]-8-(2-methoxypyrimidin-5-yl)-2-phenylisoquinolin-1-one.
| Compound Name | 3-[2-[(2-chloro-5-iodopyrimidin-4-yl)amino]ethyl]-8-(2-methoxypyrimidin-5-yl)-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 89422697 |
| Molecular Formula | C26H20ClIN6O2 |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.04 |
| IUPAC Name | 3-[2-[(2-chloro-5-iodopyrimidin-4-yl)amino]ethyl]-8-(2-methoxypyrimidin-5-yl)-2-phenylisoquinolin-1-one |
| SMILES | COc1ncc(-c2cccc3cc(CCNc4nc(Cl)ncc4I)n(-c4ccccc4)c(=O)c23)cn1 |
| InChI | InChI=1S/C26H20ClIN6O2/c1-36-26-31-13-17(14-32-26)20-9-5-6-16-12-19(10-11-29-23-21(28)15-30-25(27)33-23)34(24(35)22(16)20)18-7-3-2-4-8-18/h2-9,12-15H,10-11H2,1H3,(H,29,30,33) |
| InChIKey | ADMLGSCDOUTAEX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|