C12H19NO2 — CID 89425896
5-methyl-4-octa-1,2-dienyl-1,3-oxazolidin-2-one (PubChem CID 89425896) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-methyl-4-octa-1,2-dienyl-1,3-oxazolidin-2-one.
| Compound Name | 5-methyl-4-octa-1,2-dienyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89425896 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 5-methyl-4-octa-1,2-dienyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCC=C=CC1NC(=O)OC1C |
| InChI | InChI=1S/C12H19NO2/c1-3-4-5-6-7-8-9-11-10(2)15-12(14)13-11/h7,9-11H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | UAFCRHWOGMPJSG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|