C12H24N3O4+ — CID 89426223
[tert-butyl(methyl)amino]-[[(1S,3R)-3-carboxycyclohexyl]oxyamino]-oxoazanium (PubChem CID 89426223) has the molecular formula C12H24N3O4+ and a molecular weight of 274.34 g/mol. Its IUPAC name is [tert-butyl(methyl)amino]-[[(1S,3R)-3-carboxycyclohexyl]oxyamino]-oxoazanium.
| Compound Name | [tert-butyl(methyl)amino]-[[(1S,3R)-3-carboxycyclohexyl]oxyamino]-oxoazanium |
|---|---|
| PubChem CID | 89426223 |
| Molecular Formula | C12H24N3O4+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | [tert-butyl(methyl)amino]-[[(1S,3R)-3-carboxycyclohexyl]oxyamino]-oxoazanium |
| SMILES | CN([N+](=O)NO[C@H]1CCC[C@@H](C(=O)O)C1)C(C)(C)C |
| InChI | InChI=1S/C12H23N3O4/c1-12(2,3)14(4)15(18)13-19-10-7-5-6-9(8-10)11(16)17/h9-10H,5-8H2,1-4H3,(H-,13,16,17,18)/p+1/t9-,10+/m1/s1 |
| InChIKey | QREIRAVTLWLETD-ZJUUUORDSA-O |
| XLogP | 1.49 |
| TPSA | 81.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|