C22H23IN6O2 — CID 89426262
N-[(1R,3S)-3-hydroxycyclohexyl]-2-[6-(iodomethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 89426262) has the molecular formula C22H23IN6O2 and a molecular weight of 530.37 g/mol. Its IUPAC name is N-[(1R,3S)-3-hydroxycyclohexyl]-2-[6-(iodomethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-[(1R,3S)-3-hydroxycyclohexyl]-2-[6-(iodomethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 89426262 |
| Molecular Formula | C22H23IN6O2 |
| Molecular Weight | 530.37 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | N-[(1R,3S)-3-hydroxycyclohexyl]-2-[6-(iodomethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | Cn1nc(-c2cnc3[nH]cc(C(=O)N[C@@H]4CCC[C@H](O)C4)c3n2)c2ccc(CI)cc21 |
| InChI | InChI=1S/C22H23IN6O2/c1-29-18-7-12(9-23)5-6-15(18)19(28-29)17-11-25-21-20(27-17)16(10-24-21)22(31)26-13-3-2-4-14(30)8-13/h5-7,10-11,13-14,30H,2-4,8-9H2,1H3,(H,24,25)(H,26,31)/t13-,14+/m1/s1 |
| InChIKey | IIHBEVBHJNIWKQ-KGLIPLIRSA-N |
| XLogP | 3.48 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|