C25H35ClN4O4 — CID 89431714
(2R)-3-[[3-(tert-butylcarbamoyl)-5-chloro-2-pyridinyl]amino]-2-[(1S)-5-hydroxy-2-adamantyl]pyrrolidine-1-carboxylic acid (PubChem CID 89431714) has the molecular formula C25H35ClN4O4 and a molecular weight of 491.03 g/mol. Its IUPAC name is (2R)-3-[[3-(tert-butylcarbamoyl)-5-chloro-2-pyridinyl]amino]-2-[(1S)-5-hydroxy-2-adamantyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2R)-3-[[3-(tert-butylcarbamoyl)-5-chloro-2-pyridinyl]amino]-2-[(1S)-5-hydroxy-2-adamantyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 89431714 |
| Molecular Formula | C25H35ClN4O4 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | (2R)-3-[[3-(tert-butylcarbamoyl)-5-chloro-2-pyridinyl]amino]-2-[(1S)-5-hydroxy-2-adamantyl]pyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)NC(=O)c1cc(Cl)cnc1NC1CCN(C(=O)O)[C@@H]1C1C2CC3C[C@H]1CC(O)(C3)C2 |
| InChI | InChI=1S/C25H35ClN4O4/c1-24(2,3)29-22(31)17-8-16(26)12-27-21(17)28-18-4-5-30(23(32)33)20(18)19-14-6-13-7-15(19)11-25(34,9-13)10-14/h8,12-15,18-20,34H,4-7,9-11H2,1-3H3,(H,27,28)(H,29,31)(H,32,33)/t13?,14-,15?,18?,19?,20-,25?/m0/s1 |
| InChIKey | BVMXZYYQYUYQHQ-ZWPULYLSSA-N |
| XLogP | 3.98 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |