C20H27ClN4O3 — CID 67479724
[(1S)-5-hydroxy-2-adamantyl] (3R)-3-[(3-amino-5-chloro-2-pyridinyl)amino]pyrrolidine-1-carboxylate (PubChem CID 67479724) has the molecular formula C20H27ClN4O3 and a molecular weight of 406.91 g/mol. Its IUPAC name is [(1S)-5-hydroxy-2-adamantyl] (3R)-3-[(3-amino-5-chloro-2-pyridinyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | [(1S)-5-hydroxy-2-adamantyl] (3R)-3-[(3-amino-5-chloro-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67479724 |
| Molecular Formula | C20H27ClN4O3 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [(1S)-5-hydroxy-2-adamantyl] (3R)-3-[(3-amino-5-chloro-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
| SMILES | Nc1cc(Cl)cnc1N[C@@H]1CCN(C(=O)OC2C3CC4C[C@H]2CC(O)(C4)C3)C1 |
| InChI | InChI=1S/C20H27ClN4O3/c21-14-5-16(22)18(23-9-14)24-15-1-2-25(10-15)19(26)28-17-12-3-11-4-13(17)8-20(27,6-11)7-12/h5,9,11-13,15,17,27H,1-4,6-8,10,22H2,(H,23,24)/t11?,12-,13?,15+,17?,20?/m0/s1 |
| InChIKey | FOZSWAUXSGQYIR-HLEUPGTGSA-N |
| XLogP | 2.88 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |