About (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate
(5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 58254796) has the molecular formula C20H27N5O4
and a molecular weight of 401.47 g/mol. Its IUPAC name is (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate |
| PubChem CID | 58254796 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | NC(=O)c1cnc(N[C@@H]2CCN(C(=O)OC3C4CC5CC3CC(O)(C5)C4)C2)nc1 |
| InChI | InChI=1S/C20H27N5O4/c21-17(26)14-8-22-18(23-9-14)24-15-1-2-25(10-15)19(27)29-16-12-3-11-4-13(16)7-20(28,5-11)6-12/h8-9,11-13,15-16,28H,1-7,10H2,(H2,21,26)(H,22,23,24)/t11?,12?,13?,15-,16?,20?/m1/s1 |
| InChIKey | IKFGCIGFWOBFLY-PVDDYZRRSA-N |
| XLogP | 1.14 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate?
The IUPAC name of (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate (CID 58254796) is (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate.
What is the SMILES notation for (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate?
The canonical SMILES for (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate is NC(=O)c1cnc(N[C@@H]2CCN(C(=O)OC3C4CC5CC3CC(O)(C5)C4)C2)nc1.
What is the InChIKey of (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate?
The InChIKey is IKFGCIGFWOBFLY-PVDDYZRRSA-N. The full InChI is InChI=1S/C20H27N5O4/c21-17(26)14-8-22-18(23-9-14)24-15-1-2-25(10-15)19(27)29-16-12-3-11-4-13(16)7-20(28,5-11)6-12/h8-9,11-13,15-16,28H,1-7,10H2,(H2,21,26)(H,22,23,24)/t11?,12?,13?,15-,16?,20?/m1/s1.
What are the key properties of (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate?
(5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate has a molecular weight of 401.47 g/mol, XLogP of 1.14, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hydroxy-2-adamantyl) (3R)-3-[(5-carbamoylpyrimidin-2-yl)amino]pyrrolidine-1-carboxylate is sourced from PubChem (CID 58254796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).