C20H25ClN4O5 — CID 58171537
(5-hydroxy-2-adamantyl) (3R)-3-[(5-chloro-3-nitro-2-pyridinyl)amino]pyrrolidine-1-carboxylate (PubChem CID 58171537) has the molecular formula C20H25ClN4O5 and a molecular weight of 436.90 g/mol. Its IUPAC name is (5-hydroxy-2-adamantyl) (3R)-3-[(5-chloro-3-nitro-2-pyridinyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | (5-hydroxy-2-adamantyl) (3R)-3-[(5-chloro-3-nitro-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58171537 |
| Molecular Formula | C20H25ClN4O5 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (5-hydroxy-2-adamantyl) (3R)-3-[(5-chloro-3-nitro-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
| SMILES | O=C(OC1C2CC3CC1CC(O)(C3)C2)N1CC[C@@H](Nc2ncc(Cl)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H25ClN4O5/c21-14-5-16(25(28)29)18(22-9-14)23-15-1-2-24(10-15)19(26)30-17-12-3-11-4-13(17)8-20(27,6-11)7-12/h5,9,11-13,15,17,27H,1-4,6-8,10H2,(H,22,23)/t11?,12?,13?,15-,17?,20?/m1/s1 |
| InChIKey | SVFNVLWCVBSBKY-LJQCRTTESA-N |
| XLogP | 3.21 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|