C21H25ClN4O3 — CID 76747223
(5-hydroxy-2-adamantyl) 3-[(3-chloro-5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate (PubChem CID 76747223) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is (5-hydroxy-2-adamantyl) 3-[(3-chloro-5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | (5-hydroxy-2-adamantyl) 3-[(3-chloro-5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 76747223 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (5-hydroxy-2-adamantyl) 3-[(3-chloro-5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
| SMILES | N#Cc1cnc(NC2CCN(C(=O)OC3C4CC5CC3CC(O)(C5)C4)C2)c(Cl)c1 |
| InChI | InChI=1S/C21H25ClN4O3/c22-17-5-13(9-23)10-24-19(17)25-16-1-2-26(11-16)20(27)29-18-14-3-12-4-15(18)8-21(28,6-12)7-14/h5,10,12,14-16,18,28H,1-4,6-8,11H2,(H,24,25) |
| InChIKey | PQYNEYUVYAHMLX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |