C21H25IN4O3 — CID 66883818
(5-hydroxy-4-iodo-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate (PubChem CID 66883818) has the molecular formula C21H25IN4O3 and a molecular weight of 508.36 g/mol. Its IUPAC name is (5-hydroxy-4-iodo-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | (5-hydroxy-4-iodo-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66883818 |
| Molecular Formula | C21H25IN4O3 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | (5-hydroxy-4-iodo-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
| SMILES | N#Cc1ccc(NC2CCN(C(=O)OC3C4CC5CC3C(I)C(O)(C5)C4)C2)nc1 |
| InChI | InChI=1S/C21H25IN4O3/c22-19-16-6-13-5-14(8-21(19,28)7-13)18(16)29-20(27)26-4-3-15(11-26)25-17-2-1-12(9-23)10-24-17/h1-2,10,13-16,18-19,28H,3-8,11H2,(H,24,25) |
| InChIKey | WOUJNAAXCKYNKF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|