C23H30N4O2 — CID 58171580
(5-methyl-2-adamantyl) (3R)-3-(2-amino-4-cyanoanilino)pyrrolidine-1-carboxylate (PubChem CID 58171580) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is (5-methyl-2-adamantyl) (3R)-3-(2-amino-4-cyanoanilino)pyrrolidine-1-carboxylate.
| Compound Name | (5-methyl-2-adamantyl) (3R)-3-(2-amino-4-cyanoanilino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58171580 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (5-methyl-2-adamantyl) (3R)-3-(2-amino-4-cyanoanilino)pyrrolidine-1-carboxylate |
| SMILES | CC12CC3CC(C1)C(OC(=O)N1CC[C@@H](Nc4ccc(C#N)cc4N)C1)C(C3)C2 |
| InChI | InChI=1S/C23H30N4O2/c1-23-9-15-6-16(10-23)21(17(7-15)11-23)29-22(28)27-5-4-18(13-27)26-20-3-2-14(12-24)8-19(20)25/h2-3,8,15-18,21,26H,4-7,9-11,13,25H2,1H3/t15?,16?,17?,18-,21?,23?/m1/s1 |
| InChIKey | HNWBSJGMCWCBQX-POLXELRWSA-N |
| XLogP | 3.98 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|