C22H27F3N4O3 — CID 52940907
(5-carbamoyl-2-adamantyl) (3R)-3-[[4-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-1-carboxylate (PubChem CID 52940907) has the molecular formula C22H27F3N4O3 and a molecular weight of 452.48 g/mol. Its IUPAC name is (5-carbamoyl-2-adamantyl) (3R)-3-[[4-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | (5-carbamoyl-2-adamantyl) (3R)-3-[[4-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 52940907 |
| Molecular Formula | C22H27F3N4O3 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (5-carbamoyl-2-adamantyl) (3R)-3-[[4-(trifluoromethyl)-2-pyridinyl]amino]pyrrolidine-1-carboxylate |
| SMILES | NC(=O)C12CC3CC(C1)C(OC(=O)N1CC[C@@H](Nc4cc(C(F)(F)F)ccn4)C1)C(C3)C2 |
| InChI | InChI=1S/C22H27F3N4O3/c23-22(24,25)15-1-3-27-17(7-15)28-16-2-4-29(11-16)20(31)32-18-13-5-12-6-14(18)10-21(8-12,9-13)19(26)30/h1,3,7,12-14,16,18H,2,4-6,8-11H2,(H2,26,30)(H,27,28)/t12?,13?,14?,16-,18?,21?/m1/s1 |
| InChIKey | URHJIWIOXIKZOG-XMRBXOEBSA-N |
| XLogP | 3.40 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |