C8H13NO3S2 — CID 89433448
(2S,4R)-1-methyl-4-methylsulfanylcarbothioyloxypyrrolidine-2-carboxylic acid (PubChem CID 89433448) has the molecular formula C8H13NO3S2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (2S,4R)-1-methyl-4-methylsulfanylcarbothioyloxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-methyl-4-methylsulfanylcarbothioyloxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 89433448 |
| Molecular Formula | C8H13NO3S2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | (2S,4R)-1-methyl-4-methylsulfanylcarbothioyloxypyrrolidine-2-carboxylic acid |
| SMILES | CSC(=S)O[C@@H]1C[C@@H](C(=O)O)N(C)C1 |
| InChI | InChI=1S/C8H13NO3S2/c1-9-4-5(12-8(13)14-2)3-6(9)7(10)11/h5-6H,3-4H2,1-2H3,(H,10,11)/t5-,6+/m1/s1 |
| InChIKey | WLCVRBWUNUZOAS-RITPCOANSA-N |
| XLogP | 0.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|