C27H44O3 — CID 89434152
methyl (4R)-4-[(3S,5R,6R,8R,9S,10S,13S,14S)-3-hydroxy-3,6,10,13-tetramethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 89434152) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is methyl (4R)-4-[(3S,5R,6R,8R,9S,10S,13S,14S)-3-hydroxy-3,6,10,13-tetramethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3S,5R,6R,8R,9S,10S,13S,14S)-3-hydroxy-3,6,10,13-tetramethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 89434152 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | methyl (4R)-4-[(3S,5R,6R,8R,9S,10S,13S,14S)-3-hydroxy-3,6,10,13-tetramethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)C1=CC[C@H]2[C@@H]3C[C@@H](C)[C@H]4C[C@@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44O3/c1-17(7-10-24(28)30-6)20-8-9-21-19-15-18(2)23-16-25(3,29)13-14-27(23,5)22(19)11-12-26(20,21)4/h8,17-19,21-23,29H,7,9-16H2,1-6H3/t17-,18-,19+,21+,22+,23-,25+,26-,27-/m1/s1 |
| InChIKey | PNWOTKWFIVMBBA-BLOSIFPISA-N |
| XLogP | 6.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|