C26H42O3 — CID 155082591
methyl 4-[(3S,5R,6R,8R,9S,10S,13S,14S)-3-hydroxy-3,6,10,13-tetramethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 155082591) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is methyl 4-[(3S,5R,6R,8R,9S,10S,13S,14S)-3-hydroxy-3,6,10,13-tetramethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | methyl 4-[(3S,5R,6R,8R,9S,10S,13S,14S)-3-hydroxy-3,6,10,13-tetramethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 155082591 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | methyl 4-[(3S,5R,6R,8R,9S,10S,13S,14S)-3-hydroxy-3,6,10,13-tetramethyl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | COC(=O)CCCC1=CC[C@H]2[C@@H]3C[C@@H](C)[C@H]4C[C@@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H42O3/c1-17-15-19-20-10-9-18(7-6-8-23(27)29-5)25(20,3)12-11-21(19)26(4)14-13-24(2,28)16-22(17)26/h9,17,19-22,28H,6-8,10-16H2,1-5H3/t17-,19+,20+,21+,22-,24+,25-,26-/m1/s1 |
| InChIKey | DNFASEDKYCJFFX-IJVRCSOLSA-N |
| XLogP | 5.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|