C35H53NO2 — CID 167509964
4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-1-(2,2,5-trimethyl-3H-indol-1-yl)butan-1-one;methanol (PubChem CID 167509964) has the molecular formula C35H53NO2 and a molecular weight of 519.81 g/mol. Its IUPAC name is 4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-1-(2,2,5-trimethyl-3H-indol-1-yl)butan-1-one;methanol.
| Compound Name | 4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-1-(2,2,5-trimethyl-3H-indol-1-yl)butan-1-one;methanol |
|---|---|
| PubChem CID | 167509964 |
| Molecular Formula | C35H53NO2 |
| Molecular Weight | 519.81 g/mol |
| Exact Mass | 519.41 |
| IUPAC Name | 4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-1-(2,2,5-trimethyl-3H-indol-1-yl)butan-1-one;methanol |
| SMILES | CO.Cc1ccc2c(c1)CC(C)(C)N2C(=O)CCCC1=CCC2C3CCC4CCCCC4(C)C3CCC12C |
| InChI | InChI=1S/C34H49NO.CH4O/c1-23-12-17-30-24(21-23)22-32(2,3)35(30)31(36)11-8-10-26-14-16-28-27-15-13-25-9-6-7-19-33(25,4)29(27)18-20-34(26,28)5;1-2/h12,14,17,21,25,27-29H,6-11,13,15-16,18-20,22H2,1-5H3;2H,1H3 |
| InChIKey | NWRFGMBRNLATOC-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.81 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|