C22H31BrO2 — CID 155385209
2-[(1S,2S,5S,9S,10S,13S,15R)-15-hydroxy-5,15-dimethyl-6-pentacyclo[11.4.1.01,13.02,10.05,9]octadec-6-enyl]acetyl bromide (PubChem CID 155385209) has the molecular formula C22H31BrO2 and a molecular weight of 407.39 g/mol. Its IUPAC name is 2-[(1S,2S,5S,9S,10S,13S,15R)-15-hydroxy-5,15-dimethyl-6-pentacyclo[11.4.1.01,13.02,10.05,9]octadec-6-enyl]acetyl bromide.
| Compound Name | 2-[(1S,2S,5S,9S,10S,13S,15R)-15-hydroxy-5,15-dimethyl-6-pentacyclo[11.4.1.01,13.02,10.05,9]octadec-6-enyl]acetyl bromide |
|---|---|
| PubChem CID | 155385209 |
| Molecular Formula | C22H31BrO2 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[(1S,2S,5S,9S,10S,13S,15R)-15-hydroxy-5,15-dimethyl-6-pentacyclo[11.4.1.01,13.02,10.05,9]octadec-6-enyl]acetyl bromide |
| SMILES | C[C@@]1(O)CC[C@@]23C[C@@]2(CC[C@@H]2[C@@H]3CC[C@]3(C)C(CC(=O)Br)=CC[C@@H]23)C1 |
| InChI | InChI=1S/C22H31BrO2/c1-19(25)9-10-22-13-21(22,12-19)8-5-15-16-4-3-14(11-18(23)24)20(16,2)7-6-17(15)22/h3,15-17,25H,4-13H2,1-2H3/t15-,16-,17-,19+,20+,21+,22-/m0/s1 |
| InChIKey | INBGKTATCFTESF-CMJIXDPGSA-N |
| XLogP | 5.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|