C22H36O2 — CID 155385164
(1S,2S,5S,9S,10S,13S,15R)-6-(1-hydroxyethyl)-5,15-dimethylpentacyclo[11.4.1.01,13.02,10.05,9]octadecan-15-ol (PubChem CID 155385164) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (1S,2S,5S,9S,10S,13S,15R)-6-(1-hydroxyethyl)-5,15-dimethylpentacyclo[11.4.1.01,13.02,10.05,9]octadecan-15-ol.
| Compound Name | (1S,2S,5S,9S,10S,13S,15R)-6-(1-hydroxyethyl)-5,15-dimethylpentacyclo[11.4.1.01,13.02,10.05,9]octadecan-15-ol |
|---|---|
| PubChem CID | 155385164 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (1S,2S,5S,9S,10S,13S,15R)-6-(1-hydroxyethyl)-5,15-dimethylpentacyclo[11.4.1.01,13.02,10.05,9]octadecan-15-ol |
| SMILES | CC(O)C1CC[C@H]2[C@@H]3CC[C@]45C[C@](C)(O)CC[C@]4(C5)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H36O2/c1-14(23)16-4-5-17-15-6-9-21-12-19(2,24)10-11-22(21,13-21)18(15)7-8-20(16,17)3/h14-18,23-24H,4-13H2,1-3H3/t14?,15-,16?,17-,18-,19+,20+,21+,22-/m0/s1 |
| InChIKey | MTIRWRLJHRDFLZ-IPULMAOJSA-N |
| XLogP | 4.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |