C21H36O2 — CID 145142660
(10R)-17-(1-hydroxyethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-10-ol (PubChem CID 145142660) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (10R)-17-(1-hydroxyethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-10-ol.
| Compound Name | (10R)-17-(1-hydroxyethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-10-ol |
|---|---|
| PubChem CID | 145142660 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (10R)-17-(1-hydroxyethyl)-3,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-10-ol |
| SMILES | CC1CC[C@@]2(O)C(CCC3C4CCC(C(C)O)C4(C)CCC32)C1 |
| InChI | InChI=1S/C21H36O2/c1-13-8-11-21(23)15(12-13)4-5-16-18-7-6-17(14(2)22)20(18,3)10-9-19(16)21/h13-19,22-23H,4-12H2,1-3H3/t13?,14?,15?,16?,17?,18?,19?,20?,21-/m1/s1 |
| InChIKey | LCWNWWIPIMKJCI-SBQDPXAJSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |