C24H18Cl2FNO2 — CID 89437037
1-[[5-chloro-2-[2-(4-chloro-2-fluorophenyl)ethyl]phenyl]methyl]indole-4-carboxylic acid (PubChem CID 89437037) has the molecular formula C24H18Cl2FNO2 and a molecular weight of 442.32 g/mol. Its IUPAC name is 1-[[5-chloro-2-[2-(4-chloro-2-fluorophenyl)ethyl]phenyl]methyl]indole-4-carboxylic acid.
| Compound Name | 1-[[5-chloro-2-[2-(4-chloro-2-fluorophenyl)ethyl]phenyl]methyl]indole-4-carboxylic acid |
|---|---|
| PubChem CID | 89437037 |
| Molecular Formula | C24H18Cl2FNO2 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 1-[[5-chloro-2-[2-(4-chloro-2-fluorophenyl)ethyl]phenyl]methyl]indole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1ccn2Cc1cc(Cl)ccc1CCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C24H18Cl2FNO2/c25-18-8-6-15(4-5-16-7-9-19(26)13-22(16)27)17(12-18)14-28-11-10-20-21(24(29)30)2-1-3-23(20)28/h1-3,6-13H,4-5,14H2,(H,29,30) |
| InChIKey | MNNBGIQUAFRBMK-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |