C20H22FNO4S — CID 8943909
[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)sulfanylacetate (PubChem CID 8943909) has the molecular formula C20H22FNO4S and a molecular weight of 391.46 g/mol. Its IUPAC name is [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)sulfanylacetate.
| Compound Name | [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8943909 |
| Molecular Formula | C20H22FNO4S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(4-ethoxyphenyl)sulfanylacetate |
| SMILES | CCOc1ccc(SCC(=O)O[C@@H](C)C(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H22FNO4S/c1-3-25-17-8-10-18(11-9-17)27-13-19(23)26-14(2)20(24)22-12-15-4-6-16(21)7-5-15/h4-11,14H,3,12-13H2,1-2H3,(H,22,24)/t14-/m0/s1 |
| InChIKey | JUIJNDSRVJDLAP-AWEZNQCLSA-N |
| XLogP | 3.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |