C46H32N4 — CID 89441464
10-[6-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]naphthalen-2-yl]-2,3-dipyridin-2-ylimidazo[1,2-f]phenanthridine (PubChem CID 89441464) has the molecular formula C46H32N4 and a molecular weight of 640.79 g/mol. Its IUPAC name is 10-[6-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]naphthalen-2-yl]-2,3-dipyridin-2-ylimidazo[1,2-f]phenanthridine.
| Compound Name | 10-[6-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]naphthalen-2-yl]-2,3-dipyridin-2-ylimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 89441464 |
| Molecular Formula | C46H32N4 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | 10-[6-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]naphthalen-2-yl]-2,3-dipyridin-2-ylimidazo[1,2-f]phenanthridine |
| SMILES | C/C=C\C=C/c1ccc(-c2ccc3cc(-c4ccc5c(c4)c4ccccc4n4c(-c6ccccn6)c(-c6ccccn6)nc54)ccc3c2)cc1 |
| InChI | InChI=1S/C46H32N4/c1-2-3-4-11-31-16-18-32(19-17-31)33-20-21-35-29-36(23-22-34(35)28-33)37-24-25-39-40(30-37)38-12-5-6-15-43(38)50-45(42-14-8-10-27-48-42)44(49-46(39)50)41-13-7-9-26-47-41/h2-30H,1H3/b3-2-,11-4- |
| InChIKey | ZNZOABGNFYIWIJ-RHSAXJQZSA-N |
| XLogP | 11.84 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|