C47H33N3 — CID 89441434
10-[4-[7-[(1Z,3Z)-penta-1,3-dienyl]quinolin-2-yl]phenyl]-2,3-diphenylimidazo[1,2-f]phenanthridine (PubChem CID 89441434) has the molecular formula C47H33N3 and a molecular weight of 639.80 g/mol. Its IUPAC name is 10-[4-[7-[(1Z,3Z)-penta-1,3-dienyl]quinolin-2-yl]phenyl]-2,3-diphenylimidazo[1,2-f]phenanthridine.
| Compound Name | 10-[4-[7-[(1Z,3Z)-penta-1,3-dienyl]quinolin-2-yl]phenyl]-2,3-diphenylimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 89441434 |
| Molecular Formula | C47H33N3 |
| Molecular Weight | 639.80 g/mol |
| Exact Mass | 639.27 |
| IUPAC Name | 10-[4-[7-[(1Z,3Z)-penta-1,3-dienyl]quinolin-2-yl]phenyl]-2,3-diphenylimidazo[1,2-f]phenanthridine |
| SMILES | C/C=C\C=C/c1ccc2ccc(-c3ccc(-c4ccc5c(c4)c4ccccc4n4c(-c6ccccc6)c(-c6ccccc6)nc54)cc3)nc2c1 |
| InChI | InChI=1S/C47H33N3/c1-2-3-6-13-32-20-21-35-27-29-42(48-43(35)30-32)34-24-22-33(23-25-34)38-26-28-40-41(31-38)39-18-11-12-19-44(39)50-46(37-16-9-5-10-17-37)45(49-47(40)50)36-14-7-4-8-15-36/h2-31H,1H3/b3-2-,13-6- |
| InChIKey | KGOWQWVVRBTOJW-XUSIJGFJSA-N |
| XLogP | 12.45 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.80 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|