C7H10OS — CID 89442302
3-prop-1-en-2-yl-2,3-dihydrothiophene 1-oxide (PubChem CID 89442302) has the molecular formula C7H10OS and a molecular weight of 142.22 g/mol. Its IUPAC name is 3-prop-1-en-2-yl-2,3-dihydrothiophene 1-oxide.
| Compound Name | 3-prop-1-en-2-yl-2,3-dihydrothiophene 1-oxide |
|---|---|
| PubChem CID | 89442302 |
| Molecular Formula | C7H10OS |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 3-prop-1-en-2-yl-2,3-dihydrothiophene 1-oxide |
| SMILES | C=C(C)C1C=CS(=O)C1 |
| InChI | InChI=1S/C7H10OS/c1-6(2)7-3-4-9(8)5-7/h3-4,7H,1,5H2,2H3 |
| InChIKey | XZZRHVHBXCUGLO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|