C24H34N2O6S — CID 89442803
6-[5-(cyclohexylmethyl)-2,4,6-trioxo-1,3-diazinan-5-yl]hexyl 4-methylbenzenesulfonate (PubChem CID 89442803) has the molecular formula C24H34N2O6S and a molecular weight of 478.61 g/mol. Its IUPAC name is 6-[5-(cyclohexylmethyl)-2,4,6-trioxo-1,3-diazinan-5-yl]hexyl 4-methylbenzenesulfonate.
| Compound Name | 6-[5-(cyclohexylmethyl)-2,4,6-trioxo-1,3-diazinan-5-yl]hexyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89442803 |
| Molecular Formula | C24H34N2O6S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 6-[5-(cyclohexylmethyl)-2,4,6-trioxo-1,3-diazinan-5-yl]hexyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCC2(CC3CCCCC3)C(=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C24H34N2O6S/c1-18-11-13-20(14-12-18)33(30,31)32-16-8-3-2-7-15-24(17-19-9-5-4-6-10-19)21(27)25-23(29)26-22(24)28/h11-14,19H,2-10,15-17H2,1H3,(H2,25,26,27,28,29) |
| InChIKey | QJOYBONTEWUITA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|