C27H22F3N5O2 — CID 89443327
1-[4-(3-pyrrolidin-1-ylquinoxaline-6-carbonyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 89443327) has the molecular formula C27H22F3N5O2 and a molecular weight of 505.50 g/mol. Its IUPAC name is 1-[4-(3-pyrrolidin-1-ylquinoxaline-6-carbonyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(3-pyrrolidin-1-ylquinoxaline-6-carbonyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 89443327 |
| Molecular Formula | C27H22F3N5O2 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 1-[4-(3-pyrrolidin-1-ylquinoxaline-6-carbonyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(=O)c2ccc3ncc(N4CCCC4)nc3c2)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H22F3N5O2/c28-27(29,30)19-4-3-5-21(15-19)33-26(37)32-20-9-6-17(7-10-20)25(36)18-8-11-22-23(14-18)34-24(16-31-22)35-12-1-2-13-35/h3-11,14-16H,1-2,12-13H2,(H2,32,33,37) |
| InChIKey | QTWYXBFBAJPWDI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |