C26H19F6N5O3 — CID 71678839
1-[3-(trifluoromethyl)phenyl]-3-[2,4,5-trifluoro-3-(3-morpholin-4-ylquinoxalin-6-yl)oxyphenyl]urea (PubChem CID 71678839) has the molecular formula C26H19F6N5O3 and a molecular weight of 563.46 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]-3-[2,4,5-trifluoro-3-(3-morpholin-4-ylquinoxalin-6-yl)oxyphenyl]urea.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]-3-[2,4,5-trifluoro-3-(3-morpholin-4-ylquinoxalin-6-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 71678839 |
| Molecular Formula | C26H19F6N5O3 |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]-3-[2,4,5-trifluoro-3-(3-morpholin-4-ylquinoxalin-6-yl)oxyphenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1cc(F)c(F)c(Oc2ccc3ncc(N4CCOCC4)nc3c2)c1F |
| InChI | InChI=1S/C26H19F6N5O3/c27-17-12-20(36-25(38)34-15-3-1-2-14(10-15)26(30,31)32)23(29)24(22(17)28)40-16-4-5-18-19(11-16)35-21(13-33-18)37-6-8-39-9-7-37/h1-5,10-13H,6-9H2,(H2,34,36,38) |
| InChIKey | PGQHZLLGJGEZKW-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|